C26H34ClNO4 — CID 22962824
(E)-1-[4-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentoxy]-2-chlorophenyl]-N-methoxyethanimine (PubChem CID 22962824) has the molecular formula C26H34ClNO4 and a molecular weight of 460.01 g/mol. Its IUPAC name is (E)-1-[4-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentoxy]-2-chlorophenyl]-N-methoxyethanimine.
| Compound Name | (E)-1-[4-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentoxy]-2-chlorophenyl]-N-methoxyethanimine |
|---|---|
| PubChem CID | 22962824 |
| Molecular Formula | C26H34ClNO4 |
| Molecular Weight | 460.01 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | (E)-1-[4-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentoxy]-2-chlorophenyl]-N-methoxyethanimine |
| SMILES | C/C=C/COc1cc(C)c(OCCCCCOc2ccc(/C(C)=N/OC)c(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C26H34ClNO4/c1-6-7-13-31-23-16-19(2)26(20(3)17-23)32-15-10-8-9-14-30-22-11-12-24(25(27)18-22)21(4)28-29-5/h6-7,11-12,16-18H,8-10,13-15H2,1-5H3/b7-6+,28-21+ |
| InChIKey | HALQUVLTZFCHTH-STIHSDPFSA-N |
| XLogP | 6.91 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.01 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|