C26H34ClNO4 — CID 23379552
(E)-2-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentoxy]-1-(4-chlorophenyl)-N-methoxyethanimine (PubChem CID 23379552) has the molecular formula C26H34ClNO4 and a molecular weight of 460.01 g/mol. Its IUPAC name is (E)-2-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentoxy]-1-(4-chlorophenyl)-N-methoxyethanimine.
| Compound Name | (E)-2-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentoxy]-1-(4-chlorophenyl)-N-methoxyethanimine |
|---|---|
| PubChem CID | 23379552 |
| Molecular Formula | C26H34ClNO4 |
| Molecular Weight | 460.01 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | (E)-2-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentoxy]-1-(4-chlorophenyl)-N-methoxyethanimine |
| SMILES | C/C=C/COc1cc(C)c(OCCCCCOC/C(=N/OC)c2ccc(Cl)cc2)c(C)c1 |
| InChI | InChI=1S/C26H34ClNO4/c1-5-6-15-31-24-17-20(2)26(21(3)18-24)32-16-9-7-8-14-30-19-25(28-29-4)22-10-12-23(27)13-11-22/h5-6,10-13,17-18H,7-9,14-16,19H2,1-4H3/b6-5+,28-25- |
| InChIKey | ZBXWZPOFDSWBPL-LYQHYEPESA-N |
| XLogP | 6.53 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.01 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|