C27H37NO3 — CID 59905158
(E)-1-[3-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentyl]phenyl]-N-methoxypropan-1-imine (PubChem CID 59905158) has the molecular formula C27H37NO3 and a molecular weight of 423.60 g/mol. Its IUPAC name is (E)-1-[3-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentyl]phenyl]-N-methoxypropan-1-imine.
| Compound Name | (E)-1-[3-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentyl]phenyl]-N-methoxypropan-1-imine |
|---|---|
| PubChem CID | 59905158 |
| Molecular Formula | C27H37NO3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | (E)-1-[3-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentyl]phenyl]-N-methoxypropan-1-imine |
| SMILES | C/C=C/COc1cc(C)c(OCCCCCc2cccc(/C(CC)=N/OC)c2)c(C)c1 |
| InChI | InChI=1S/C27H37NO3/c1-6-8-16-30-25-18-21(3)27(22(4)19-25)31-17-11-9-10-13-23-14-12-15-24(20-23)26(7-2)28-29-5/h6,8,12,14-15,18-20H,7,9-11,13,16-17H2,1-5H3/b8-6+,28-26+ |
| InChIKey | IKHOCVQPCLMEQP-PGEGNYBYSA-N |
| XLogP | 6.81 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|