C23H30N2O4 — CID 59910259
(E)-1-[6-[2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]ethoxy]-3-pyridinyl]-N-methoxypropan-1-imine (PubChem CID 59910259) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is (E)-1-[6-[2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]ethoxy]-3-pyridinyl]-N-methoxypropan-1-imine.
| Compound Name | (E)-1-[6-[2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]ethoxy]-3-pyridinyl]-N-methoxypropan-1-imine |
|---|---|
| PubChem CID | 59910259 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | (E)-1-[6-[2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]ethoxy]-3-pyridinyl]-N-methoxypropan-1-imine |
| SMILES | C/C=C/COc1cc(C)c(OCCOc2ccc(/C(CC)=N/OC)cn2)c(C)c1 |
| InChI | InChI=1S/C23H30N2O4/c1-6-8-11-27-20-14-17(3)23(18(4)15-20)29-13-12-28-22-10-9-19(16-24-22)21(7-2)25-26-5/h6,8-10,14-16H,7,11-13H2,1-5H3/b8-6+,25-21+ |
| InChIKey | SABWABGEXAFTIE-KZIJYRRFSA-N |
| XLogP | 4.87 |
| TPSA | 62.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|