C27H35F3N2O4 — CID 23379465
(Z)-1-[6-[7-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]heptoxy]-3-pyridinyl]-2,2,2-trifluoro-N-methoxyethanimine (PubChem CID 23379465) has the molecular formula C27H35F3N2O4 and a molecular weight of 508.58 g/mol. Its IUPAC name is (Z)-1-[6-[7-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]heptoxy]-3-pyridinyl]-2,2,2-trifluoro-N-methoxyethanimine.
| Compound Name | (Z)-1-[6-[7-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]heptoxy]-3-pyridinyl]-2,2,2-trifluoro-N-methoxyethanimine |
|---|---|
| PubChem CID | 23379465 |
| Molecular Formula | C27H35F3N2O4 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | (Z)-1-[6-[7-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]heptoxy]-3-pyridinyl]-2,2,2-trifluoro-N-methoxyethanimine |
| SMILES | C/C=C/COc1cc(C)c(OCCCCCCCOc2ccc(/C(=N/OC)C(F)(F)F)cn2)c(C)c1 |
| InChI | InChI=1S/C27H35F3N2O4/c1-5-6-14-34-23-17-20(2)25(21(3)18-23)36-16-11-9-7-8-10-15-35-24-13-12-22(19-31-24)26(32-33-4)27(28,29)30/h5-6,12-13,17-19H,7-11,14-16H2,1-4H3/b6-5+,32-26- |
| InChIKey | QCRZSDXVSGIUOF-SENIOQATSA-N |
| XLogP | 6.97 |
| TPSA | 62.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|