C23H27F3N2O4 — CID 23379442
(Z)-1-[6-[3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]propoxy]-3-pyridinyl]-2,2,2-trifluoro-N-methoxyethanimine (PubChem CID 23379442) has the molecular formula C23H27F3N2O4 and a molecular weight of 452.47 g/mol. Its IUPAC name is (Z)-1-[6-[3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]propoxy]-3-pyridinyl]-2,2,2-trifluoro-N-methoxyethanimine.
| Compound Name | (Z)-1-[6-[3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]propoxy]-3-pyridinyl]-2,2,2-trifluoro-N-methoxyethanimine |
|---|---|
| PubChem CID | 23379442 |
| Molecular Formula | C23H27F3N2O4 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | (Z)-1-[6-[3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]propoxy]-3-pyridinyl]-2,2,2-trifluoro-N-methoxyethanimine |
| SMILES | C/C=C/COc1cc(C)c(OCCCOc2ccc(/C(=N/OC)C(F)(F)F)cn2)c(C)c1 |
| InChI | InChI=1S/C23H27F3N2O4/c1-5-6-10-30-19-13-16(2)21(17(3)14-19)32-12-7-11-31-20-9-8-18(15-27-20)22(28-29-4)23(24,25)26/h5-6,8-9,13-15H,7,10-12H2,1-4H3/b6-5+,28-22- |
| InChIKey | TUPCLQPIPCNIRV-JSZHTNKOSA-N |
| XLogP | 5.41 |
| TPSA | 62.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|