C29H39F3N2O4 — CID 23379434
(Z)-1-[5-[9-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]nonoxy]-2-pyridinyl]-2,2,2-trifluoro-N-methoxyethanimine (PubChem CID 23379434) has the molecular formula C29H39F3N2O4 and a molecular weight of 536.64 g/mol. Its IUPAC name is (Z)-1-[5-[9-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]nonoxy]-2-pyridinyl]-2,2,2-trifluoro-N-methoxyethanimine.
| Compound Name | (Z)-1-[5-[9-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]nonoxy]-2-pyridinyl]-2,2,2-trifluoro-N-methoxyethanimine |
|---|---|
| PubChem CID | 23379434 |
| Molecular Formula | C29H39F3N2O4 |
| Molecular Weight | 536.64 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | (Z)-1-[5-[9-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]nonoxy]-2-pyridinyl]-2,2,2-trifluoro-N-methoxyethanimine |
| SMILES | C/C=C/COc1cc(C)c(OCCCCCCCCCOc2ccc(/C(=N/OC)C(F)(F)F)nc2)c(C)c1 |
| InChI | InChI=1S/C29H39F3N2O4/c1-5-6-16-37-25-19-22(2)27(23(3)20-25)38-18-13-11-9-7-8-10-12-17-36-24-14-15-26(33-21-24)28(34-35-4)29(30,31)32/h5-6,14-15,19-21H,7-13,16-18H2,1-4H3/b6-5+,34-28- |
| InChIKey | JTKWDEHZMDQRDI-ZMGLXXEKSA-N |
| XLogP | 7.75 |
| TPSA | 62.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.64 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|