C24H27F4NO4 — CID 23379309
(Z)-1-[4-[3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]propoxy]-3-fluorophenyl]-2,2,2-trifluoro-N-methoxyethanimine (PubChem CID 23379309) has the molecular formula C24H27F4NO4 and a molecular weight of 469.48 g/mol. Its IUPAC name is (Z)-1-[4-[3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]propoxy]-3-fluorophenyl]-2,2,2-trifluoro-N-methoxyethanimine.
| Compound Name | (Z)-1-[4-[3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]propoxy]-3-fluorophenyl]-2,2,2-trifluoro-N-methoxyethanimine |
|---|---|
| PubChem CID | 23379309 |
| Molecular Formula | C24H27F4NO4 |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | (Z)-1-[4-[3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]propoxy]-3-fluorophenyl]-2,2,2-trifluoro-N-methoxyethanimine |
| SMILES | C/C=C/COc1cc(C)c(OCCCOc2ccc(/C(=N/OC)C(F)(F)F)cc2F)c(C)c1 |
| InChI | InChI=1S/C24H27F4NO4/c1-5-6-10-31-19-13-16(2)22(17(3)14-19)33-12-7-11-32-21-9-8-18(15-20(21)25)23(29-30-4)24(26,27)28/h5-6,8-9,13-15H,7,10-12H2,1-4H3/b6-5+,29-23- |
| InChIKey | XKRBFFAJKYLYIQ-WFRMFQGDSA-N |
| XLogP | 6.16 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|