C27H34F3NO4 — CID 91200593
(E)-1-[3-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]hexan-2-yloxy]phenyl]-2,2,2-trifluoro-N-methoxyethanimine (PubChem CID 91200593) has the molecular formula C27H34F3NO4 and a molecular weight of 493.57 g/mol. Its IUPAC name is (E)-1-[3-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]hexan-2-yloxy]phenyl]-2,2,2-trifluoro-N-methoxyethanimine.
| Compound Name | (E)-1-[3-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]hexan-2-yloxy]phenyl]-2,2,2-trifluoro-N-methoxyethanimine |
|---|---|
| PubChem CID | 91200593 |
| Molecular Formula | C27H34F3NO4 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | (E)-1-[3-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]hexan-2-yloxy]phenyl]-2,2,2-trifluoro-N-methoxyethanimine |
| SMILES | C/C=C/COc1cc(C)c(OC(C)CCC(C)Oc2cccc(/C(=N\OC)C(F)(F)F)c2)c(C)c1 |
| InChI | InChI=1S/C27H34F3NO4/c1-7-8-14-33-24-15-18(2)25(19(3)16-24)35-21(5)13-12-20(4)34-23-11-9-10-22(17-23)26(31-32-6)27(28,29)30/h7-11,15-17,20-21H,12-14H2,1-6H3/b8-7+,31-26+ |
| InChIKey | PGNPMHHNGHFBHT-FNBIFOGLSA-N |
| XLogP | 7.19 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|