C27H33NO4 — CID 22962501
(E)-1-[3-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]hex-3-yn-2-yloxy]phenyl]-N-methoxyethanimine (PubChem CID 22962501) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is (E)-1-[3-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]hex-3-yn-2-yloxy]phenyl]-N-methoxyethanimine.
| Compound Name | (E)-1-[3-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]hex-3-yn-2-yloxy]phenyl]-N-methoxyethanimine |
|---|---|
| PubChem CID | 22962501 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | (E)-1-[3-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]hex-3-yn-2-yloxy]phenyl]-N-methoxyethanimine |
| SMILES | C/C=C/COc1cc(C)c(OC(C)C#CC(C)Oc2cccc(/C(C)=N/OC)c2)c(C)c1 |
| InChI | InChI=1S/C27H33NO4/c1-8-9-15-30-26-16-19(2)27(20(3)17-26)32-22(5)14-13-21(4)31-25-12-10-11-24(18-25)23(6)28-29-7/h8-12,16-18,21-22H,15H2,1-7H3/b9-8+,28-23+ |
| InChIKey | WHTSDGTUYOYFIY-PSBTXIPJSA-N |
| XLogP | 5.87 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|