C27H35NO4 — CID 90904834
(Z)-1-[3-[4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]but-2-ynoxy]phenyl]-N-methoxyethanimine;ethane (PubChem CID 90904834) has the molecular formula C27H35NO4 and a molecular weight of 437.58 g/mol. Its IUPAC name is (Z)-1-[3-[4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]but-2-ynoxy]phenyl]-N-methoxyethanimine;ethane.
| Compound Name | (Z)-1-[3-[4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]but-2-ynoxy]phenyl]-N-methoxyethanimine;ethane |
|---|---|
| PubChem CID | 90904834 |
| Molecular Formula | C27H35NO4 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | (Z)-1-[3-[4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]but-2-ynoxy]phenyl]-N-methoxyethanimine;ethane |
| SMILES | C/C=C/COc1cc(C)c(OCC#CCOc2cccc(/C(C)=N\OC)c2)c(C)c1.CC |
| InChI | InChI=1S/C25H29NO4.C2H6/c1-6-7-13-29-24-16-19(2)25(20(3)17-24)30-15-9-8-14-28-23-12-10-11-22(18-23)21(4)26-27-5;1-2/h6-7,10-12,16-18H,13-15H2,1-5H3;1-2H3/b7-6+,26-21-; |
| InChIKey | JDSBPIXYWSFCLO-RQNPHCBOSA-N |
| XLogP | 6.12 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|