C28H41NO4 — CID 90985926
(Z)-1-[3-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]hexan-2-yloxy]phenyl]-N-methoxymethanimine;ethane (PubChem CID 90985926) has the molecular formula C28H41NO4 and a molecular weight of 455.64 g/mol. Its IUPAC name is (Z)-1-[3-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]hexan-2-yloxy]phenyl]-N-methoxymethanimine;ethane.
| Compound Name | (Z)-1-[3-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]hexan-2-yloxy]phenyl]-N-methoxymethanimine;ethane |
|---|---|
| PubChem CID | 90985926 |
| Molecular Formula | C28H41NO4 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.30 |
| IUPAC Name | (Z)-1-[3-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]hexan-2-yloxy]phenyl]-N-methoxymethanimine;ethane |
| SMILES | C/C=C/COc1cc(C)c(OC(C)CCC(C)Oc2cccc(/C=N\OC)c2)c(C)c1.CC |
| InChI | InChI=1S/C26H35NO4.C2H6/c1-7-8-14-29-25-15-19(2)26(20(3)16-25)31-22(5)13-12-21(4)30-24-11-9-10-23(17-24)18-27-28-6;1-2/h7-11,15-18,21-22H,12-14H2,1-6H3;1-2H3/b8-7+,27-18-; |
| InChIKey | SQRMUSCDOIPZOY-JHCZWJOTSA-N |
| XLogP | 7.28 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|