C25H35NO3S — CID 158831631
1-[4-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl-diethyl-λ4-sulfanyl]phenyl]-N-methoxymethanimine (PubChem CID 158831631) has the molecular formula C25H35NO3S and a molecular weight of 429.63 g/mol. Its IUPAC name is 1-[4-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl-diethyl-λ4-sulfanyl]phenyl]-N-methoxymethanimine.
| Compound Name | 1-[4-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl-diethyl-λ4-sulfanyl]phenyl]-N-methoxymethanimine |
|---|---|
| PubChem CID | 158831631 |
| Molecular Formula | C25H35NO3S |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 1-[4-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl-diethyl-λ4-sulfanyl]phenyl]-N-methoxymethanimine |
| SMILES | C/C=C/COc1cc(C)c(OCS(CC)(CC)c2ccc(C=NOC)cc2)c(C)c1 |
| InChI | InChI=1S/C25H35NO3S/c1-7-10-15-28-23-16-20(4)25(21(5)17-23)29-19-30(8-2,9-3)24-13-11-22(12-14-24)18-26-27-6/h7,10-14,16-18H,8-9,15,19H2,1-6H3/b10-7+,26-18? |
| InChIKey | DQABSPHCYVJGQC-YVRPXXNOSA-N |
| XLogP | 6.48 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|