C26H33NO4 — CID 22962617
(E)-1-[4-[[2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]cyclopentyl]oxymethyl]phenyl]-N-methoxymethanimine (PubChem CID 22962617) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is (E)-1-[4-[[2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]cyclopentyl]oxymethyl]phenyl]-N-methoxymethanimine.
| Compound Name | (E)-1-[4-[[2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]cyclopentyl]oxymethyl]phenyl]-N-methoxymethanimine |
|---|---|
| PubChem CID | 22962617 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | (E)-1-[4-[[2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]cyclopentyl]oxymethyl]phenyl]-N-methoxymethanimine |
| SMILES | C/C=C/COc1cc(C)c(OC2CCCC2OCc2ccc(/C=N/OC)cc2)c(C)c1 |
| InChI | InChI=1S/C26H33NO4/c1-5-6-14-29-23-15-19(2)26(20(3)16-23)31-25-9-7-8-24(25)30-18-22-12-10-21(11-13-22)17-27-28-4/h5-6,10-13,15-17,24-25H,7-9,14,18H2,1-4H3/b6-5+,27-17+ |
| InChIKey | DCDKSDCLGSVJQV-JHVREWCZSA-N |
| XLogP | 5.76 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|