C27H37NO5 — CID 160879801
2-[4-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentoxymethyl]phenoxy]-N-methoxyethanimine (PubChem CID 160879801) has the molecular formula C27H37NO5 and a molecular weight of 455.60 g/mol. Its IUPAC name is 2-[4-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentoxymethyl]phenoxy]-N-methoxyethanimine.
| Compound Name | 2-[4-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentoxymethyl]phenoxy]-N-methoxyethanimine |
|---|---|
| PubChem CID | 160879801 |
| Molecular Formula | C27H37NO5 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | 2-[4-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentoxymethyl]phenoxy]-N-methoxyethanimine |
| SMILES | C/C=C/COc1cc(C)c(OCCCCCOCc2ccc(OCC=NOC)cc2)c(C)c1 |
| InChI | InChI=1S/C27H37NO5/c1-5-6-16-31-26-19-22(2)27(23(3)20-26)33-17-9-7-8-15-30-21-24-10-12-25(13-11-24)32-18-14-28-29-4/h5-6,10-14,19-20H,7-9,15-18,21H2,1-4H3/b6-5+,28-14? |
| InChIKey | VZILKUZGVAIRBH-MMDZPMSVSA-N |
| XLogP | 6.04 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|