C18H28N2O3 — CID 161425468
3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-N-(2-methoxyiminoethyl)propan-1-amine (PubChem CID 161425468) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is 3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-N-(2-methoxyiminoethyl)propan-1-amine.
| Compound Name | 3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-N-(2-methoxyiminoethyl)propan-1-amine |
|---|---|
| PubChem CID | 161425468 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-N-(2-methoxyiminoethyl)propan-1-amine |
| SMILES | C/C=C/COc1cc(C)c(OCCCNCC=NOC)c(C)c1 |
| InChI | InChI=1S/C18H28N2O3/c1-5-6-11-22-17-13-15(2)18(16(3)14-17)23-12-7-8-19-9-10-20-21-4/h5-6,10,13-14,19H,7-9,11-12H2,1-4H3/b6-5+,20-10? |
| InChIKey | NAULHQSFVKDUSU-YWGJVFGLSA-N |
| XLogP | 3.25 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|