C21H34N2O4 — CID 158394086
N-[2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]ethyl]-N-ethyl-2-(2-methoxyiminoethoxy)ethanamine (PubChem CID 158394086) has the molecular formula C21H34N2O4 and a molecular weight of 378.51 g/mol. Its IUPAC name is N-[2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]ethyl]-N-ethyl-2-(2-methoxyiminoethoxy)ethanamine.
| Compound Name | N-[2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]ethyl]-N-ethyl-2-(2-methoxyiminoethoxy)ethanamine |
|---|---|
| PubChem CID | 158394086 |
| Molecular Formula | C21H34N2O4 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | N-[2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]ethyl]-N-ethyl-2-(2-methoxyiminoethoxy)ethanamine |
| SMILES | C/C=C/COc1cc(C)c(OCCN(CC)CCOCC=NOC)c(C)c1 |
| InChI | InChI=1S/C21H34N2O4/c1-6-8-12-26-20-16-18(3)21(19(4)17-20)27-15-11-23(7-2)10-14-25-13-9-22-24-5/h6,8-9,16-17H,7,10-15H2,1-5H3/b8-6+,22-9? |
| InChIKey | RLPHVUYDYHLHEJ-KMZXQQKZSA-N |
| XLogP | 3.61 |
| TPSA | 52.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|