C16H24N2O3 — CID 22963199
4-[(E)-but-2-enoxy]-N-[[(2E)-2-methoxyiminoethoxy]methyl]-2,6-dimethylaniline (PubChem CID 22963199) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 4-[(E)-but-2-enoxy]-N-[[(2E)-2-methoxyiminoethoxy]methyl]-2,6-dimethylaniline.
| Compound Name | 4-[(E)-but-2-enoxy]-N-[[(2E)-2-methoxyiminoethoxy]methyl]-2,6-dimethylaniline |
|---|---|
| PubChem CID | 22963199 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 4-[(E)-but-2-enoxy]-N-[[(2E)-2-methoxyiminoethoxy]methyl]-2,6-dimethylaniline |
| SMILES | C/C=C/COc1cc(C)c(NCOC/C=N/OC)c(C)c1 |
| InChI | InChI=1S/C16H24N2O3/c1-5-6-8-21-15-10-13(2)16(14(3)11-15)17-12-20-9-7-18-19-4/h5-7,10-11,17H,8-9,12H2,1-4H3/b6-5+,18-7+ |
| InChIKey | KBYURBSUBKFAFN-YIMHWZMDSA-N |
| XLogP | 3.28 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|