C15H22N2O2 — CID 157296356
N-[(E)-but-2-enyl]-4-(2-methoxyiminoethoxy)-3,5-dimethylaniline (PubChem CID 157296356) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-4-(2-methoxyiminoethoxy)-3,5-dimethylaniline.
| Compound Name | N-[(E)-but-2-enyl]-4-(2-methoxyiminoethoxy)-3,5-dimethylaniline |
|---|---|
| PubChem CID | 157296356 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N-[(E)-but-2-enyl]-4-(2-methoxyiminoethoxy)-3,5-dimethylaniline |
| SMILES | C/C=C/CNc1cc(C)c(OCC=NOC)c(C)c1 |
| InChI | InChI=1S/C15H22N2O2/c1-5-6-7-16-14-10-12(2)15(13(3)11-14)19-9-8-17-18-4/h5-6,8,10-11,16H,7,9H2,1-4H3/b6-5+,17-8? |
| InChIKey | FNYNWENJKHIOAV-OWZKXSOQSA-N |
| XLogP | 3.30 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|