C17H25NO5S — CID 23379484
(E)-2-[2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]ethylsulfonyl]-N-methoxyethanimine (PubChem CID 23379484) has the molecular formula C17H25NO5S and a molecular weight of 355.46 g/mol. Its IUPAC name is (E)-2-[2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]ethylsulfonyl]-N-methoxyethanimine.
| Compound Name | (E)-2-[2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]ethylsulfonyl]-N-methoxyethanimine |
|---|---|
| PubChem CID | 23379484 |
| Molecular Formula | C17H25NO5S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | (E)-2-[2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]ethylsulfonyl]-N-methoxyethanimine |
| SMILES | C/C=C/COc1cc(C)c(OCCS(=O)(=O)C/C=N/OC)c(C)c1 |
| InChI | InChI=1S/C17H25NO5S/c1-5-6-8-22-16-12-14(2)17(15(3)13-16)23-9-11-24(19,20)10-7-18-21-4/h5-7,12-13H,8-11H2,1-4H3/b6-5+,18-7+ |
| InChIKey | MHKWUMMJXKJQKR-YIMHWZMDSA-N |
| XLogP | 2.68 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|