C17H25NO5S — CID 90713845
(Z)-1-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methylsulfonyl]-N-methoxypropan-2-imine (PubChem CID 90713845) has the molecular formula C17H25NO5S and a molecular weight of 355.46 g/mol. Its IUPAC name is (Z)-1-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methylsulfonyl]-N-methoxypropan-2-imine.
| Compound Name | (Z)-1-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methylsulfonyl]-N-methoxypropan-2-imine |
|---|---|
| PubChem CID | 90713845 |
| Molecular Formula | C17H25NO5S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | (Z)-1-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methylsulfonyl]-N-methoxypropan-2-imine |
| SMILES | C/C=C/COc1cc(C)c(OCS(=O)(=O)C/C(C)=N\OC)c(C)c1 |
| InChI | InChI=1S/C17H25NO5S/c1-6-7-8-22-16-9-13(2)17(14(3)10-16)23-12-24(19,20)11-15(4)18-21-5/h6-7,9-10H,8,11-12H2,1-5H3/b7-6+,18-15- |
| InChIKey | LFAYORLWLMOWRE-BOZSEJOSSA-N |
| XLogP | 3.03 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|