C24H31NO5S — CID 161425469
2-[3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]propylsulfonyl]-N-methoxy-1-phenylethanimine (PubChem CID 161425469) has the molecular formula C24H31NO5S and a molecular weight of 445.58 g/mol. Its IUPAC name is 2-[3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]propylsulfonyl]-N-methoxy-1-phenylethanimine.
| Compound Name | 2-[3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]propylsulfonyl]-N-methoxy-1-phenylethanimine |
|---|---|
| PubChem CID | 161425469 |
| Molecular Formula | C24H31NO5S |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 2-[3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]propylsulfonyl]-N-methoxy-1-phenylethanimine |
| SMILES | C/C=C/COc1cc(C)c(OCCCS(=O)(=O)CC(=NOC)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C24H31NO5S/c1-5-6-13-29-22-16-19(2)24(20(3)17-22)30-14-10-15-31(26,27)18-23(25-28-4)21-11-8-7-9-12-21/h5-9,11-12,16-17H,10,13-15,18H2,1-4H3/b6-5+,25-23? |
| InChIKey | YQMZLUISNASVCY-ZMDWRANXSA-N |
| XLogP | 4.49 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|