C27H37NO5S — CID 161425475
1-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentylsulfonyl]-N-methoxy-3-phenylpropan-2-imine (PubChem CID 161425475) has the molecular formula C27H37NO5S and a molecular weight of 487.66 g/mol. Its IUPAC name is 1-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentylsulfonyl]-N-methoxy-3-phenylpropan-2-imine.
| Compound Name | 1-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentylsulfonyl]-N-methoxy-3-phenylpropan-2-imine |
|---|---|
| PubChem CID | 161425475 |
| Molecular Formula | C27H37NO5S |
| Molecular Weight | 487.66 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 1-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentylsulfonyl]-N-methoxy-3-phenylpropan-2-imine |
| SMILES | C/C=C/COc1cc(C)c(OCCCCCS(=O)(=O)CC(Cc2ccccc2)=NOC)c(C)c1 |
| InChI | InChI=1S/C27H37NO5S/c1-5-6-15-32-26-18-22(2)27(23(3)19-26)33-16-11-8-12-17-34(29,30)21-25(28-31-4)20-24-13-9-7-10-14-24/h5-7,9-10,13-14,18-19H,8,11-12,15-17,20-21H2,1-4H3/b6-5+,28-25? |
| InChIKey | CDOYDEUZVBHAJR-RJJBVWNXSA-N |
| XLogP | 5.47 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.66 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|