C27H38N2O3 — CID 22963179
4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-N-[(2E)-2-methoxyimino-3-phenylpropyl]-N-methylbutan-1-amine (PubChem CID 22963179) has the molecular formula C27H38N2O3 and a molecular weight of 438.61 g/mol. Its IUPAC name is 4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-N-[(2E)-2-methoxyimino-3-phenylpropyl]-N-methylbutan-1-amine.
| Compound Name | 4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-N-[(2E)-2-methoxyimino-3-phenylpropyl]-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 22963179 |
| Molecular Formula | C27H38N2O3 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | 4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-N-[(2E)-2-methoxyimino-3-phenylpropyl]-N-methylbutan-1-amine |
| SMILES | C/C=C/COc1cc(C)c(OCCCCN(C)C/C(Cc2ccccc2)=N/OC)c(C)c1 |
| InChI | InChI=1S/C27H38N2O3/c1-6-7-16-31-26-18-22(2)27(23(3)19-26)32-17-12-11-15-29(4)21-25(28-30-5)20-24-13-9-8-10-14-24/h6-10,13-14,18-19H,11-12,15-17,20-21H2,1-5H3/b7-6+,28-25+ |
| InChIKey | NKDVVEVAVZNFAR-FBLAFPGZSA-N |
| XLogP | 5.59 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|