C28H40N2O3 — CID 22963243
6-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-N-[(2E)-2-methoxyimino-3-phenylpropyl]hexan-1-amine (PubChem CID 22963243) has the molecular formula C28H40N2O3 and a molecular weight of 452.64 g/mol. Its IUPAC name is 6-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-N-[(2E)-2-methoxyimino-3-phenylpropyl]hexan-1-amine.
| Compound Name | 6-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-N-[(2E)-2-methoxyimino-3-phenylpropyl]hexan-1-amine |
|---|---|
| PubChem CID | 22963243 |
| Molecular Formula | C28H40N2O3 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | 6-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-N-[(2E)-2-methoxyimino-3-phenylpropyl]hexan-1-amine |
| SMILES | C/C=C/COc1cc(C)c(OCCCCCCNC/C(Cc2ccccc2)=N/OC)c(C)c1 |
| InChI | InChI=1S/C28H40N2O3/c1-5-6-17-32-27-19-23(2)28(24(3)20-27)33-18-13-8-7-12-16-29-22-26(30-31-4)21-25-14-10-9-11-15-25/h5-6,9-11,14-15,19-20,29H,7-8,12-13,16-18,21-22H2,1-4H3/b6-5+,30-26+ |
| InChIKey | MXTYLDFBDYSBHN-NLJKXMAYSA-N |
| XLogP | 6.03 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|