C20H31NO6S — CID 158394085
2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]ethyl 2-(2-methoxyiminopropoxy)ethanesulfinate (PubChem CID 158394085) has the molecular formula C20H31NO6S and a molecular weight of 413.54 g/mol. Its IUPAC name is 2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]ethyl 2-(2-methoxyiminopropoxy)ethanesulfinate.
| Compound Name | 2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]ethyl 2-(2-methoxyiminopropoxy)ethanesulfinate |
|---|---|
| PubChem CID | 158394085 |
| Molecular Formula | C20H31NO6S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]ethyl 2-(2-methoxyiminopropoxy)ethanesulfinate |
| SMILES | C/C=C/COc1cc(C)c(OCCOS(=O)CCOCC(C)=NOC)c(C)c1 |
| InChI | InChI=1S/C20H31NO6S/c1-6-7-8-25-19-13-16(2)20(17(3)14-19)26-9-10-27-28(22)12-11-24-15-18(4)21-23-5/h6-7,13-14H,8-12,15H2,1-5H3/b7-6+,21-18? |
| InChIKey | KCOLMJHJAJSFFP-FEECNENTSA-N |
| XLogP | 3.36 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|