C28H39NO5 — CID 22962840
(E)-1-[4-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentoxymethyl]phenoxy]-N-methoxypropan-2-imine (PubChem CID 22962840) has the molecular formula C28H39NO5 and a molecular weight of 469.62 g/mol. Its IUPAC name is (E)-1-[4-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentoxymethyl]phenoxy]-N-methoxypropan-2-imine.
| Compound Name | (E)-1-[4-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentoxymethyl]phenoxy]-N-methoxypropan-2-imine |
|---|---|
| PubChem CID | 22962840 |
| Molecular Formula | C28H39NO5 |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | (E)-1-[4-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentoxymethyl]phenoxy]-N-methoxypropan-2-imine |
| SMILES | C/C=C/COc1cc(C)c(OCCCCCOCc2ccc(OC/C(C)=N/OC)cc2)c(C)c1 |
| InChI | InChI=1S/C28H39NO5/c1-6-7-16-32-27-18-22(2)28(23(3)19-27)33-17-10-8-9-15-31-21-25-11-13-26(14-12-25)34-20-24(4)29-30-5/h6-7,11-14,18-19H,8-10,15-17,20-21H2,1-5H3/b7-6+,29-24+ |
| InChIKey | ORXGBNGVXXWPED-MJSMXXMUSA-N |
| XLogP | 6.43 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|