C27H37NO4 — CID 22963143
(E)-3-[3-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentoxy]phenyl]-N-methoxypropan-1-imine (PubChem CID 22963143) has the molecular formula C27H37NO4 and a molecular weight of 439.60 g/mol. Its IUPAC name is (E)-3-[3-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentoxy]phenyl]-N-methoxypropan-1-imine.
| Compound Name | (E)-3-[3-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentoxy]phenyl]-N-methoxypropan-1-imine |
|---|---|
| PubChem CID | 22963143 |
| Molecular Formula | C27H37NO4 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | (E)-3-[3-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]pentoxy]phenyl]-N-methoxypropan-1-imine |
| SMILES | C/C=C/COc1cc(C)c(OCCCCCOc2cccc(CC/C=N/OC)c2)c(C)c1 |
| InChI | InChI=1S/C27H37NO4/c1-5-6-16-31-26-19-22(2)27(23(3)20-26)32-18-9-7-8-17-30-25-14-10-12-24(21-25)13-11-15-28-29-4/h5-6,10,12,14-15,19-21H,7-9,11,13,16-18H2,1-4H3/b6-5+,28-15+ |
| InChIKey | WVIZPMBJYBCEQJ-ZEEXJKGCSA-N |
| XLogP | 6.45 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|