C22H24F3NO3 — CID 91544857
(Z)-1-[4-[1-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-2,2,2-trifluoroethyl]phenyl]-N-methoxymethanimine (PubChem CID 91544857) has the molecular formula C22H24F3NO3 and a molecular weight of 407.43 g/mol. Its IUPAC name is (Z)-1-[4-[1-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-2,2,2-trifluoroethyl]phenyl]-N-methoxymethanimine.
| Compound Name | (Z)-1-[4-[1-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-2,2,2-trifluoroethyl]phenyl]-N-methoxymethanimine |
|---|---|
| PubChem CID | 91544857 |
| Molecular Formula | C22H24F3NO3 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | (Z)-1-[4-[1-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-2,2,2-trifluoroethyl]phenyl]-N-methoxymethanimine |
| SMILES | C/C=C/COc1cc(C)c(OC(c2ccc(/C=N\OC)cc2)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C22H24F3NO3/c1-5-6-11-28-19-12-15(2)20(16(3)13-19)29-21(22(23,24)25)18-9-7-17(8-10-18)14-26-27-4/h5-10,12-14,21H,11H2,1-4H3/b6-5+,26-14- |
| InChIKey | KMGJGMLAXFLDDZ-QRYBLXQYSA-N |
| XLogP | 5.92 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|