C27H35NO4 — CID 158381363
1-[4-[[2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]cyclopentyl]oxymethyl]phenyl]-N-methoxyethanimine (PubChem CID 158381363) has the molecular formula C27H35NO4 and a molecular weight of 437.58 g/mol. Its IUPAC name is 1-[4-[[2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]cyclopentyl]oxymethyl]phenyl]-N-methoxyethanimine.
| Compound Name | 1-[4-[[2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]cyclopentyl]oxymethyl]phenyl]-N-methoxyethanimine |
|---|---|
| PubChem CID | 158381363 |
| Molecular Formula | C27H35NO4 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | 1-[4-[[2-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]cyclopentyl]oxymethyl]phenyl]-N-methoxyethanimine |
| SMILES | C/C=C/COc1cc(C)c(OC2CCCC2OCc2ccc(C(C)=NOC)cc2)c(C)c1 |
| InChI | InChI=1S/C27H35NO4/c1-6-7-15-30-24-16-19(2)27(20(3)17-24)32-26-10-8-9-25(26)31-18-22-11-13-23(14-12-22)21(4)28-29-5/h6-7,11-14,16-17,25-26H,8-10,15,18H2,1-5H3/b7-6+,28-21? |
| InChIKey | IETACCKNDFSRAJ-HFAQFVFASA-N |
| XLogP | 6.15 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|