C26H35NO4 — CID 22962648
(E)-1-[4-[3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-2,2-dimethylpropoxy]phenyl]-N-methoxyethanimine (PubChem CID 22962648) has the molecular formula C26H35NO4 and a molecular weight of 425.57 g/mol. Its IUPAC name is (E)-1-[4-[3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-2,2-dimethylpropoxy]phenyl]-N-methoxyethanimine.
| Compound Name | (E)-1-[4-[3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-2,2-dimethylpropoxy]phenyl]-N-methoxyethanimine |
|---|---|
| PubChem CID | 22962648 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | (E)-1-[4-[3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-2,2-dimethylpropoxy]phenyl]-N-methoxyethanimine |
| SMILES | C/C=C/COc1cc(C)c(OCC(C)(C)COc2ccc(/C(C)=N/OC)cc2)c(C)c1 |
| InChI | InChI=1S/C26H35NO4/c1-8-9-14-29-24-15-19(2)25(20(3)16-24)31-18-26(5,6)17-30-23-12-10-22(11-13-23)21(4)27-28-7/h8-13,15-16H,14,17-18H2,1-7H3/b9-8+,27-21+ |
| InChIKey | BCPKPFUIMVGHHP-PQOXHIORSA-N |
| XLogP | 6.11 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|