C29H39NO4 — CID 157432472
1-[4-[[4-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl]cyclohexyl]methoxy]phenyl]-N-methoxyethanimine (PubChem CID 157432472) has the molecular formula C29H39NO4 and a molecular weight of 465.63 g/mol. Its IUPAC name is 1-[4-[[4-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl]cyclohexyl]methoxy]phenyl]-N-methoxyethanimine.
| Compound Name | 1-[4-[[4-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl]cyclohexyl]methoxy]phenyl]-N-methoxyethanimine |
|---|---|
| PubChem CID | 157432472 |
| Molecular Formula | C29H39NO4 |
| Molecular Weight | 465.63 g/mol |
| Exact Mass | 465.29 |
| IUPAC Name | 1-[4-[[4-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl]cyclohexyl]methoxy]phenyl]-N-methoxyethanimine |
| SMILES | C/C=C/COc1cc(C)c(OCC2CCC(COc3ccc(C(C)=NOC)cc3)CC2)c(C)c1 |
| InChI | InChI=1S/C29H39NO4/c1-6-7-16-32-28-17-21(2)29(22(3)18-28)34-20-25-10-8-24(9-11-25)19-33-27-14-12-26(13-15-27)23(4)30-31-5/h6-7,12-15,17-18,24-25H,8-11,16,19-20H2,1-5H3/b7-6+,30-23? |
| InChIKey | WXXBEDWMZQJZNH-PQVPDYFGSA-N |
| XLogP | 6.89 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.63 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|