C22H33NO4 — CID 22962530
(E)-1-[3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]cyclohexyl]oxy-N-methoxypropan-2-imine (PubChem CID 22962530) has the molecular formula C22H33NO4 and a molecular weight of 375.51 g/mol. Its IUPAC name is (E)-1-[3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]cyclohexyl]oxy-N-methoxypropan-2-imine.
| Compound Name | (E)-1-[3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]cyclohexyl]oxy-N-methoxypropan-2-imine |
|---|---|
| PubChem CID | 22962530 |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | (E)-1-[3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]cyclohexyl]oxy-N-methoxypropan-2-imine |
| SMILES | C/C=C/COc1cc(C)c(OC2CCCC(OC/C(C)=N/OC)C2)c(C)c1 |
| InChI | InChI=1S/C22H33NO4/c1-6-7-11-25-21-12-16(2)22(17(3)13-21)27-20-10-8-9-19(14-20)26-15-18(4)23-24-5/h6-7,12-13,19-20H,8-11,14-15H2,1-5H3/b7-6+,23-18+ |
| InChIKey | FONXLYNMXQQWAL-BPCMSFOVSA-N |
| XLogP | 4.99 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|