C26H32FNO4 — CID 22962759
(1Z)-4-[4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]cyclohexyl]oxy-N-methoxybenzenecarboximidoyl fluoride (PubChem CID 22962759) has the molecular formula C26H32FNO4 and a molecular weight of 441.54 g/mol. Its IUPAC name is (1Z)-4-[4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]cyclohexyl]oxy-N-methoxybenzenecarboximidoyl fluoride.
| Compound Name | (1Z)-4-[4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]cyclohexyl]oxy-N-methoxybenzenecarboximidoyl fluoride |
|---|---|
| PubChem CID | 22962759 |
| Molecular Formula | C26H32FNO4 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | (1Z)-4-[4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]cyclohexyl]oxy-N-methoxybenzenecarboximidoyl fluoride |
| SMILES | C/C=C/COc1cc(C)c(OC2CCC(Oc3ccc(/C(F)=N/OC)cc3)CC2)c(C)c1 |
| InChI | InChI=1S/C26H32FNO4/c1-5-6-15-30-24-16-18(2)25(19(3)17-24)32-23-13-11-22(12-14-23)31-21-9-7-20(8-10-21)26(27)28-29-4/h5-10,16-17,22-23H,11-15H2,1-4H3/b6-5+,28-26- |
| InChIKey | YATDKWMNSQZPIM-SCKHZXTGSA-N |
| XLogP | 6.30 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|