C24H29F4NO3 — CID 91409659
(E)-1-[4-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl]-3-fluorophenyl]-2,2,2-trifluoro-N-methoxyethanimine;ethane (PubChem CID 91409659) has the molecular formula C24H29F4NO3 and a molecular weight of 455.49 g/mol. Its IUPAC name is (E)-1-[4-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl]-3-fluorophenyl]-2,2,2-trifluoro-N-methoxyethanimine;ethane.
| Compound Name | (E)-1-[4-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl]-3-fluorophenyl]-2,2,2-trifluoro-N-methoxyethanimine;ethane |
|---|---|
| PubChem CID | 91409659 |
| Molecular Formula | C24H29F4NO3 |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | (E)-1-[4-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl]-3-fluorophenyl]-2,2,2-trifluoro-N-methoxyethanimine;ethane |
| SMILES | C/C=C/COc1cc(C)c(OCc2ccc(/C(=N\OC)C(F)(F)F)cc2F)c(C)c1.CC |
| InChI | InChI=1S/C22H23F4NO3.C2H6/c1-5-6-9-29-18-10-14(2)20(15(3)11-18)30-13-17-8-7-16(12-19(17)23)21(27-28-4)22(24,25)26;1-2/h5-8,10-12H,9,13H2,1-4H3;1-2H3/b6-5+,27-21+; |
| InChIKey | DASGXMNOXRHDIV-MZUQVILLSA-N |
| XLogP | 6.92 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|