C11H21F3N2O — CID 160816876
4,4,4-trifluoro-3-methyl-N-(2-morpholin-4-ylethyl)butan-1-amine (PubChem CID 160816876) has the molecular formula C11H21F3N2O and a molecular weight of 254.30 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-methyl-N-(2-morpholin-4-ylethyl)butan-1-amine.
| Compound Name | 4,4,4-trifluoro-3-methyl-N-(2-morpholin-4-ylethyl)butan-1-amine |
|---|---|
| PubChem CID | 160816876 |
| Molecular Formula | C11H21F3N2O |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 4,4,4-trifluoro-3-methyl-N-(2-morpholin-4-ylethyl)butan-1-amine |
| SMILES | CC(CCNCCN1CCOCC1)C(F)(F)F |
| InChI | InChI=1S/C11H21F3N2O/c1-10(11(12,13)14)2-3-15-4-5-16-6-8-17-9-7-16/h10,15H,2-9H2,1H3 |
| InChIKey | IHNBWQBCOACOJL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|