C26H23F4N3O4 — CID 160817530
N-[5-[2-[4-(2-fluoro-3-pyridinyl)phenyl]acetyl]-2-(trifluoromethoxy)phenyl]-2-morpholin-4-ylacetamide (PubChem CID 160817530) has the molecular formula C26H23F4N3O4 and a molecular weight of 517.48 g/mol. Its IUPAC name is N-[5-[2-[4-(2-fluoro-3-pyridinyl)phenyl]acetyl]-2-(trifluoromethoxy)phenyl]-2-morpholin-4-ylacetamide.
| Compound Name | N-[5-[2-[4-(2-fluoro-3-pyridinyl)phenyl]acetyl]-2-(trifluoromethoxy)phenyl]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 160817530 |
| Molecular Formula | C26H23F4N3O4 |
| Molecular Weight | 517.48 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | N-[5-[2-[4-(2-fluoro-3-pyridinyl)phenyl]acetyl]-2-(trifluoromethoxy)phenyl]-2-morpholin-4-ylacetamide |
| SMILES | O=C(CN1CCOCC1)Nc1cc(C(=O)Cc2ccc(-c3cccnc3F)cc2)ccc1OC(F)(F)F |
| InChI | InChI=1S/C26H23F4N3O4/c27-25-20(2-1-9-31-25)18-5-3-17(4-6-18)14-22(34)19-7-8-23(37-26(28,29)30)21(15-19)32-24(35)16-33-10-12-36-13-11-33/h1-9,15H,10-14,16H2,(H,32,35) |
| InChIKey | SFCDTGFCFZMUHJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|