C30H34N2O5 — CID 161191064
N-[2-(3-methoxypropoxy)-5-[2-(4-phenylphenyl)acetyl]phenyl]-2-morpholin-4-ylacetamide (PubChem CID 161191064) has the molecular formula C30H34N2O5 and a molecular weight of 502.61 g/mol. Its IUPAC name is N-[2-(3-methoxypropoxy)-5-[2-(4-phenylphenyl)acetyl]phenyl]-2-morpholin-4-ylacetamide.
| Compound Name | N-[2-(3-methoxypropoxy)-5-[2-(4-phenylphenyl)acetyl]phenyl]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 161191064 |
| Molecular Formula | C30H34N2O5 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | N-[2-(3-methoxypropoxy)-5-[2-(4-phenylphenyl)acetyl]phenyl]-2-morpholin-4-ylacetamide |
| SMILES | COCCCOc1ccc(C(=O)Cc2ccc(-c3ccccc3)cc2)cc1NC(=O)CN1CCOCC1 |
| InChI | InChI=1S/C30H34N2O5/c1-35-16-5-17-37-29-13-12-26(21-27(29)31-30(34)22-32-14-18-36-19-15-32)28(33)20-23-8-10-25(11-9-23)24-6-3-2-4-7-24/h2-4,6-13,21H,5,14-20,22H2,1H3,(H,31,34) |
| InChIKey | UTSOVGOPABLPRZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|