C29H32N2O4 — CID 162074516
N-[2-methoxy-5-[2-(4-phenylphenyl)acetyl]phenyl]-2-morpholin-4-ylbutanamide (PubChem CID 162074516) has the molecular formula C29H32N2O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is N-[2-methoxy-5-[2-(4-phenylphenyl)acetyl]phenyl]-2-morpholin-4-ylbutanamide.
| Compound Name | N-[2-methoxy-5-[2-(4-phenylphenyl)acetyl]phenyl]-2-morpholin-4-ylbutanamide |
|---|---|
| PubChem CID | 162074516 |
| Molecular Formula | C29H32N2O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | N-[2-methoxy-5-[2-(4-phenylphenyl)acetyl]phenyl]-2-morpholin-4-ylbutanamide |
| SMILES | CCC(C(=O)Nc1cc(C(=O)Cc2ccc(-c3ccccc3)cc2)ccc1OC)N1CCOCC1 |
| InChI | InChI=1S/C29H32N2O4/c1-3-26(31-15-17-35-18-16-31)29(33)30-25-20-24(13-14-28(25)34-2)27(32)19-21-9-11-23(12-10-21)22-7-5-4-6-8-22/h4-14,20,26H,3,15-19H2,1-2H3,(H,30,33) |
| InChIKey | ZBNLJKMVQUUNAW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |