C27H30N4O4 — CID 90459335
4-[4-(aminomethyl)phenyl]-N-[4-methoxy-3-[(2-morpholin-4-ylacetyl)amino]phenyl]benzamide (PubChem CID 90459335) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is 4-[4-(aminomethyl)phenyl]-N-[4-methoxy-3-[(2-morpholin-4-ylacetyl)amino]phenyl]benzamide.
| Compound Name | 4-[4-(aminomethyl)phenyl]-N-[4-methoxy-3-[(2-morpholin-4-ylacetyl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 90459335 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 4-[4-(aminomethyl)phenyl]-N-[4-methoxy-3-[(2-morpholin-4-ylacetyl)amino]phenyl]benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(-c3ccc(CN)cc3)cc2)cc1NC(=O)CN1CCOCC1 |
| InChI | InChI=1S/C27H30N4O4/c1-34-25-11-10-23(16-24(25)30-26(32)18-31-12-14-35-15-13-31)29-27(33)22-8-6-21(7-9-22)20-4-2-19(17-28)3-5-20/h2-11,16H,12-15,17-18,28H2,1H3,(H,29,33)(H,30,32) |
| InChIKey | SOLLLHZXTLCNSS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |