C20H23ClN4O4 — CID 3568292
N-[5-[(2-chlorophenyl)carbamoylamino]-2-methoxyphenyl]-2-morpholin-4-ylacetamide (PubChem CID 3568292) has the molecular formula C20H23ClN4O4 and a molecular weight of 418.88 g/mol. Its IUPAC name is N-[5-[(2-chlorophenyl)carbamoylamino]-2-methoxyphenyl]-2-morpholin-4-ylacetamide.
| Compound Name | N-[5-[(2-chlorophenyl)carbamoylamino]-2-methoxyphenyl]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 3568292 |
| Molecular Formula | C20H23ClN4O4 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | N-[5-[(2-chlorophenyl)carbamoylamino]-2-methoxyphenyl]-2-morpholin-4-ylacetamide |
| SMILES | COc1ccc(NC(=O)Nc2ccccc2Cl)cc1NC(=O)CN1CCOCC1 |
| InChI | InChI=1S/C20H23ClN4O4/c1-28-18-7-6-14(22-20(27)24-16-5-3-2-4-15(16)21)12-17(18)23-19(26)13-25-8-10-29-11-9-25/h2-7,12H,8-11,13H2,1H3,(H,23,26)(H2,22,24,27) |
| InChIKey | ZSVWJAVPINDCLC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |