C20H23ClN4O4 — CID 8844622
2-[[2-(5-acetamido-2-methoxyanilino)-2-oxoethyl]-methylamino]-N-(2-chlorophenyl)acetamide (PubChem CID 8844622) has the molecular formula C20H23ClN4O4 and a molecular weight of 418.88 g/mol. Its IUPAC name is 2-[[2-(5-acetamido-2-methoxyanilino)-2-oxoethyl]-methylamino]-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-[[2-(5-acetamido-2-methoxyanilino)-2-oxoethyl]-methylamino]-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 8844622 |
| Molecular Formula | C20H23ClN4O4 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 2-[[2-(5-acetamido-2-methoxyanilino)-2-oxoethyl]-methylamino]-N-(2-chlorophenyl)acetamide |
| SMILES | COc1ccc(NC(C)=O)cc1NC(=O)CN(C)CC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C20H23ClN4O4/c1-13(26)22-14-8-9-18(29-3)17(10-14)24-20(28)12-25(2)11-19(27)23-16-7-5-4-6-15(16)21/h4-10H,11-12H2,1-3H3,(H,22,26)(H,23,27)(H,24,28) |
| InChIKey | FXISPCNNDZVIID-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |