C29H33N3O5 — CID 86298920
4-(3-methoxypropoxy)-3-[(2-morpholin-4-ylacetyl)amino]-N-(4-phenylphenyl)benzamide (PubChem CID 86298920) has the molecular formula C29H33N3O5 and a molecular weight of 503.60 g/mol. Its IUPAC name is 4-(3-methoxypropoxy)-3-[(2-morpholin-4-ylacetyl)amino]-N-(4-phenylphenyl)benzamide.
| Compound Name | 4-(3-methoxypropoxy)-3-[(2-morpholin-4-ylacetyl)amino]-N-(4-phenylphenyl)benzamide |
|---|---|
| PubChem CID | 86298920 |
| Molecular Formula | C29H33N3O5 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 4-(3-methoxypropoxy)-3-[(2-morpholin-4-ylacetyl)amino]-N-(4-phenylphenyl)benzamide |
| SMILES | COCCCOc1ccc(C(=O)Nc2ccc(-c3ccccc3)cc2)cc1NC(=O)CN1CCOCC1 |
| InChI | InChI=1S/C29H33N3O5/c1-35-16-5-17-37-27-13-10-24(20-26(27)31-28(33)21-32-14-18-36-19-15-32)29(34)30-25-11-8-23(9-12-25)22-6-3-2-4-7-22/h2-4,6-13,20H,5,14-19,21H2,1H3,(H,30,34)(H,31,33) |
| InChIKey | XPPMBBOYPBUUEV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|