C22H21FN6O4 — CID 160817541
5-[(2-fluorophenyl)methyl]-N-[(7S)-9-methyl-8-oxo-6,7-dihydro-[1,3]oxazolo[5,4-h][1,5]benzoxazepin-7-yl]-1H-1,2,4-triazole-3-carboxamide;methane (PubChem CID 160817541) has the molecular formula C22H21FN6O4 and a molecular weight of 452.45 g/mol. Its IUPAC name is 5-[(2-fluorophenyl)methyl]-N-[(7S)-9-methyl-8-oxo-6,7-dihydro-[1,3]oxazolo[5,4-h][1,5]benzoxazepin-7-yl]-1H-1,2,4-triazole-3-carboxamide;methane.
| Compound Name | 5-[(2-fluorophenyl)methyl]-N-[(7S)-9-methyl-8-oxo-6,7-dihydro-[1,3]oxazolo[5,4-h][1,5]benzoxazepin-7-yl]-1H-1,2,4-triazole-3-carboxamide;methane |
|---|---|
| PubChem CID | 160817541 |
| Molecular Formula | C22H21FN6O4 |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 5-[(2-fluorophenyl)methyl]-N-[(7S)-9-methyl-8-oxo-6,7-dihydro-[1,3]oxazolo[5,4-h][1,5]benzoxazepin-7-yl]-1H-1,2,4-triazole-3-carboxamide;methane |
| SMILES | C.CN1C(=O)[C@@H](NC(=O)c2n[nH]c(Cc3ccccc3F)n2)COc2cc3ncoc3cc21 |
| InChI | InChI=1S/C21H17FN6O4.CH4/c1-28-15-8-16-13(23-10-32-16)7-17(15)31-9-14(21(28)30)24-20(29)19-25-18(26-27-19)6-11-4-2-3-5-12(11)22;/h2-5,7-8,10,14H,6,9H2,1H3,(H,24,29)(H,25,26,27);1H4/t14-;/m0./s1 |
| InChIKey | SFCFPMMFYFBBBB-UQKRIMTDSA-N |
| XLogP | 2.47 |
| TPSA | 126.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |