C24H23FN6O3 — CID 166786235
5-[(2-fluorophenyl)methyl]-N-[(3S)-5-methyl-7-(3-methylbut-1-ynyl)-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 166786235) has the molecular formula C24H23FN6O3 and a molecular weight of 462.49 g/mol. Its IUPAC name is 5-[(2-fluorophenyl)methyl]-N-[(3S)-5-methyl-7-(3-methylbut-1-ynyl)-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-[(2-fluorophenyl)methyl]-N-[(3S)-5-methyl-7-(3-methylbut-1-ynyl)-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 166786235 |
| Molecular Formula | C24H23FN6O3 |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 5-[(2-fluorophenyl)methyl]-N-[(3S)-5-methyl-7-(3-methylbut-1-ynyl)-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | CC(C)C#Cc1ccc2c(n1)N(C)C(=O)[C@@H](NC(=O)c1n[nH]c(Cc3ccccc3F)n1)CO2 |
| InChI | InChI=1S/C24H23FN6O3/c1-14(2)8-9-16-10-11-19-22(26-16)31(3)24(33)18(13-34-19)27-23(32)21-28-20(29-30-21)12-15-6-4-5-7-17(15)25/h4-7,10-11,14,18H,12-13H2,1-3H3,(H,27,32)(H,28,29,30)/t18-/m0/s1 |
| InChIKey | QJORGZQDEHGDTB-SFHVURJKSA-N |
| XLogP | 2.09 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|