C32H39Br2ClN8O8 — CID 160821006
6-bromo-4-chloro-3-nitroquinoline;tert-butyl N-(2-aminoethyl)carbamate;tert-butyl N-[2-[(6-bromo-3-nitroquinolin-4-yl)amino]ethyl]carbamate (PubChem CID 160821006) has the molecular formula C32H39Br2ClN8O8 and a molecular weight of 858.97 g/mol. Its IUPAC name is 6-bromo-4-chloro-3-nitroquinoline;tert-butyl N-(2-aminoethyl)carbamate;tert-butyl N-[2-[(6-bromo-3-nitroquinolin-4-yl)amino]ethyl]carbamate.
| Compound Name | 6-bromo-4-chloro-3-nitroquinoline;tert-butyl N-(2-aminoethyl)carbamate;tert-butyl N-[2-[(6-bromo-3-nitroquinolin-4-yl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 160821006 |
| Molecular Formula | C32H39Br2ClN8O8 |
| Molecular Weight | 858.97 g/mol |
| Exact Mass | 856.09 |
| IUPAC Name | 6-bromo-4-chloro-3-nitroquinoline;tert-butyl N-(2-aminoethyl)carbamate;tert-butyl N-[2-[(6-bromo-3-nitroquinolin-4-yl)amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCN.CC(C)(C)OC(=O)NCCNc1c([N+](=O)[O-])cnc2ccc(Br)cc12.O=[N+]([O-])c1cnc2ccc(Br)cc2c1Cl |
| InChI | InChI=1S/C16H19BrN4O4.C9H4BrClN2O2.C7H16N2O2/c1-16(2,3)25-15(22)19-7-6-18-14-11-8-10(17)4-5-12(11)20-9-13(14)21(23)24;10-5-1-2-7-6(3-5)9(11)8(4-12-7)13(14)15;1-7(2,3)11-6(10)9-5-4-8/h4-5,8-9H,6-7H2,1-3H3,(H,18,20)(H,19,22);1-4H;4-5,8H2,1-3H3,(H,9,10) |
| InChIKey | SFNYEHXFHPCGLB-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 226.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.97 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|