C8H7Cl2F3O — CID 160821263
1,2-dichlorobenzene;2,2,2-trifluoroethanol (PubChem CID 160821263) has the molecular formula C8H7Cl2F3O and a molecular weight of 247.04 g/mol. Its IUPAC name is 1,2-dichlorobenzene;2,2,2-trifluoroethanol.
| Compound Name | 1,2-dichlorobenzene;2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 160821263 |
| Molecular Formula | C8H7Cl2F3O |
| Molecular Weight | 247.04 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | 1,2-dichlorobenzene;2,2,2-trifluoroethanol |
| SMILES | Clc1ccccc1Cl.OCC(F)(F)F |
| InChI | InChI=1S/C6H4Cl2.C2H3F3O/c7-5-3-1-2-4-6(5)8;3-2(4,5)1-6/h1-4H;6H,1H2 |
| InChIKey | SFORYAGIACABSI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.04 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |