C24H19Cl3O5 — CID 160828630
2-chloro-9-hydroxyfluorene-9-carboxylic acid;methyl 2-chloro-3-(4-chlorophenyl)propanoate (PubChem CID 160828630) has the molecular formula C24H19Cl3O5 and a molecular weight of 493.77 g/mol. Its IUPAC name is 2-chloro-9-hydroxyfluorene-9-carboxylic acid;methyl 2-chloro-3-(4-chlorophenyl)propanoate.
| Compound Name | 2-chloro-9-hydroxyfluorene-9-carboxylic acid;methyl 2-chloro-3-(4-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 160828630 |
| Molecular Formula | C24H19Cl3O5 |
| Molecular Weight | 493.77 g/mol |
| Exact Mass | 492.03 |
| IUPAC Name | 2-chloro-9-hydroxyfluorene-9-carboxylic acid;methyl 2-chloro-3-(4-chlorophenyl)propanoate |
| SMILES | COC(=O)C(Cl)Cc1ccc(Cl)cc1.O=C(O)C1(O)c2ccccc2-c2ccc(Cl)cc21 |
| InChI | InChI=1S/C14H9ClO3.C10H10Cl2O2/c15-8-5-6-10-9-3-1-2-4-11(9)14(18,13(16)17)12(10)7-8;1-14-10(13)9(12)6-7-2-4-8(11)5-3-7/h1-7,18H,(H,16,17);2-5,9H,6H2,1H3 |
| InChIKey | SGMWEIQUQROJPM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.77 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|