C16H21N5O4 — CID 160828649
6-prop-2-enoxy-3-[4-(2-propoxyacetyl)triazol-1-yl]-1,6-diazabicyclo[3.2.1]oct-3-en-7-one (PubChem CID 160828649) has the molecular formula C16H21N5O4 and a molecular weight of 347.38 g/mol. Its IUPAC name is 6-prop-2-enoxy-3-[4-(2-propoxyacetyl)triazol-1-yl]-1,6-diazabicyclo[3.2.1]oct-3-en-7-one.
| Compound Name | 6-prop-2-enoxy-3-[4-(2-propoxyacetyl)triazol-1-yl]-1,6-diazabicyclo[3.2.1]oct-3-en-7-one |
|---|---|
| PubChem CID | 160828649 |
| Molecular Formula | C16H21N5O4 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 6-prop-2-enoxy-3-[4-(2-propoxyacetyl)triazol-1-yl]-1,6-diazabicyclo[3.2.1]oct-3-en-7-one |
| SMILES | C=CCON1C(=O)N2CC(n3cc(C(=O)COCCC)nn3)=CC1C2 |
| InChI | InChI=1S/C16H21N5O4/c1-3-5-24-11-15(22)14-10-20(18-17-14)12-7-13-9-19(8-12)16(23)21(13)25-6-4-2/h4,7,10,13H,2-3,5-6,8-9,11H2,1H3 |
| InChIKey | NKXAOFGDZXCXQM-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 89.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|