C12H16N6O7S — CID 159557347
[3-[4-[2-(2-aminoethoxy)acetyl]triazol-1-yl]-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] hydrogen sulfate (PubChem CID 159557347) has the molecular formula C12H16N6O7S and a molecular weight of 388.36 g/mol. Its IUPAC name is [3-[4-[2-(2-aminoethoxy)acetyl]triazol-1-yl]-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] hydrogen sulfate.
| Compound Name | [3-[4-[2-(2-aminoethoxy)acetyl]triazol-1-yl]-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 159557347 |
| Molecular Formula | C12H16N6O7S |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | [3-[4-[2-(2-aminoethoxy)acetyl]triazol-1-yl]-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] hydrogen sulfate |
| SMILES | NCCOCC(=O)c1cn(C2=CC3CN(C2)C(=O)N3OS(=O)(=O)O)nn1 |
| InChI | InChI=1S/C12H16N6O7S/c13-1-2-24-7-11(19)10-6-17(15-14-10)8-3-9-5-16(4-8)12(20)18(9)25-26(21,22)23/h3,6,9H,1-2,4-5,7,13H2,(H,21,22,23) |
| InChIKey | CKCQLPLABNMRMA-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 170.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|